Decarboxylated 8,5'-diferulic acid
|
|
| Names
|
Preferred IUPAC name
(2E)-3-{4-Hydroxy-3-[(E)-2-(4-hydroxy-3-methoxyphenyl)ethen-1-yl]-5-methoxyphenyl}prop-2-enoic acid
|
| Other names
8,5'-DiFA (DC) 8,5'-diFA (decarboxylated form); Poacic acid
|
| Identifiers
|
|
|
|
|
|
|
| ChEBI
|
|
| ChEMBL
|
|
| ChemSpider
|
|
|
|
|
|
|
|
InChI=1S/C19H18O6/c1-24-16-10-12(4-7-15(16)20)3-6-14-9-13(5-8-18(21)22)11-17(25-2)19(14)23/h3-11,20,23H,1-2H3,(H,21,22)/b6-3+,8-5+ Key: SLIMCXCSQXYCGL-JENUQAQBSA-N InChI=1/C19H18O6/c1-24-16-10-12(4-7-15(16)20)3-6-14-9-13(5-8-18(21)22)11-17(25-2)19(14)23/h3-11,20,23H,1-2H3,(H,21,22)/b6-3+,8-5+ Key: SLIMCXCSQXYCGL-JENUQAQBBX
|
Oc2c(OC)cc(\C=C\C(O)=O)cc2\C=C\c(cc1OC)ccc1O
|
| Properties
|
|
|
C19H18O6
|
| Molar mass
|
342.347 g·mol−1
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
Decarboxylated 8,5'-diferulic acid is a molecule included in the group but is not a true diferulic acid. It is found in maize bran.[1]
See also
References
- ^ Bunzel, M; Funk, C; Steinhart, H (2004). "Semipreparative isolation of dehydrodiferulic and dehydrotriferulic acids as standard substances from maize bran". Journal of Separation Science. 27 (13): 1080–6. doi:10.1002/jssc.200301703. PMID 15495409.
|
|---|
| Aglycones | | Precursor | |
|---|
Monohydroxycinnamic acids (Coumaric acids) | |
|---|
| Dihydroxycinnamic acids | |
|---|
| Trihydroxycinnamic acids | |
|---|
| O-methylated forms | |
|---|
| others | |
|---|
|
|---|
| Esters | | glycoside-likes | Esters of caffeic acid with cyclitols | |
|---|
| Glycosides | |
|---|
|
|---|
| Tartaric acid esters | |
|---|
Other esters with caffeic acid | |
|---|
Caffeoyl phenylethanoid glycoside (CPG) |
- Echinacoside
- Calceolarioside A, B, C, F
- Chiritoside A, B, C
- Cistanoside A, B, C, D, E, F, G, H
- Conandroside
- Myconoside
- Pauoifloside
- Plantainoside A
- Plantamajoside
- Tubuloside B
- Verbascoside (Isoverbascoside, 2′-Acetylverbascoside)
|
|---|
|
|---|
| Oligomeric forms | | Dimers |
- Diferulic acids (DiFA) : 5,5′-Diferulic acid, 8-O-4′-Diferulic acid, 8,5′-Diferulic acid, 8,5′-DiFA (DC), 8,5′-DiFA (BF), 8,8′-Diferulic acid
|
|---|
| Trimers | |
|---|
| Tetramers | |
|---|
|
|---|
Conjugates with coenzyme A (CoA) | |
|---|