HHCP-O-acetate |
|
(6aR,10aR)-6,6,9-trimethyl-3-heptyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-yl acetate
|
| CAS Number | |
|---|
|
| Formula | C25H38O3 |
|---|
| Molar mass | 386.576 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
CC(=O)Oc1cc(CCCCCCC)cc2OC(C)(C)[C@@H]3CCC(C)C[C@H]3c21
|
InChI=1S/C25H38O3/c1-6-7-8-9-10-11-19-15-22(27-18(3)26)24-20-14-17(2)12-13-21(20)25(4,5)28-23(24)16-19/h15-17,20-21H,6-14H2,1-5H3/t17?,20-,21-/m1/s1 Key:LRVWJGANNJYLTC-LTGQRPFBSA-N
|
HHCP-O-acetate (HHCPO, HHCP-O) is a semi-synthetic derivative of tetrahydrocannabiphorol (THCP) derived in several steps by hydrogenation to hexahydrocannabiphorol (HHCP) followed by acetylation of the OH group. It has been found as a component of grey-market cannabis products such as e-cigarette liquids and edible gumdrops, and is allegedly a potent and long-lasting psychoactive cannabinoid.[1]
Confusion about acronym
Some vendors have mistakenly claimed that HHCPO stands for hexahydrocannabinol propionate (HHC-P) or hexahydrocannabinol cyclopropyl ether, but these are different compounds.
See also
References
|
|---|
Phytocannabinoids (comparison) | | Cannabibutols | |
|---|
| Cannabichromenes | |
|---|
| Cannabicyclols | |
|---|
| Cannabidiols | |
|---|
| Cannabielsoins | |
|---|
| Cannabigerols | |
|---|
| Cannabiphorols | |
|---|
| Cannabinols |
- CBN
- CBNA
- CBN-C1
- CBN-C2
- CBN-C4
- CBNM
- CBND
- CBNP
- CBVD
|
|---|
| Cannabitriols | |
|---|
| Cannabivarins | |
|---|
| Delta-3-tetrahydrocannabinols | |
|---|
| Delta-4-tetrahydrocannabinols | |
|---|
| Delta-7-tetrahydrocannabinols | |
|---|
| Delta-8-tetrahydrocannabinols | |
|---|
| Delta-9-tetrahydrocannabinols | |
|---|
| Delta-10-Tetrahydrocannabinols | |
|---|
| Delta-11-Tetrahydrocannabinols | |
|---|
| Miscellaneous cannabinoids | |
|---|
| Active metabolites | |
|---|
|
|---|
| Endocannabinoids | |
|---|
Synthetic cannabinoid receptor agonists / neocannabinoids | Classical cannabinoids (dibenzopyrans) | |
|---|
Non-classical cannabinoids | |
|---|
| Adamantoylindoles | |
|---|
| Benzimidazoles | |
|---|
| Benzoylindoles | |
|---|
| Cyclohexylphenols | |
|---|
| Eicosanoids | |
|---|
Indazole-3- carboxamides | |
|---|
| Indole-3-carboxamides | |
|---|
| Indole-3-carboxylates | |
|---|
| Naphthoylindazoles | |
|---|
| Naphthoylindoles | |
|---|
| Naphthoylpyrroles | |
|---|
| Naphthylmethylindenes | |
|---|
| Naphthylmethylindoles | |
|---|
| Phenylacetylindoles | |
|---|
| Pyrazolecarboxamides | |
|---|
Tetramethylcyclo- propanoylindazoles | |
|---|
Tetramethylcyclo- propanoylindoles | |
|---|
| Others | |
|---|
|
|---|
| Allosteric CBRTooltip Cannabinoid receptor ligands | |
|---|
Endocannabinoid enhancers (inactivation inhibitors) | |
|---|
Anticannabinoids (antagonists/inverse agonists/antibodies) | |
|---|
|