NS-398
|
|
|
|
| Names
|
Preferred IUPAC name
N-[2-(Cyclohexyloxy)-4-nitrophenyl]methanesulfonamide
|
| Identifiers
|
|
|
|
|
|
|
| ChEBI
|
|
| ChEMBL
|
|
| ChemSpider
|
|
| DrugBank
|
|
|
|
|
|
|
|
|
|
|
InChI=1S/C13H18N2O5S/c1-21(18,19)14-12-8-7-10(15(16)17)9-13(12)20-11-5-3-2-4-6-11/h7-9,11,14H,2-6H2,1H3 Y Key: KTDZCOWXCWUPEO-UHFFFAOYSA-N N InChI=1/C13H18N2O5S/c1-21(18,19)14-12-8-7-10(15(16)17)9-13(12)20-11-5-3-2-4-6-11/h7-9,11,14H,2-6H2,1H3 Key: KTDZCOWXCWUPEO-UHFFFAOYAY
|
CS(=O)(=O)NC1=C(C=C(C=C1)[N+](=O)[O-])OC2CCCCC2
|
| Properties
|
|
|
C13H18N2O5S
|
| Molar mass
|
314.36 g·mol−1
|
| Appearance
|
Off-white solid
|
|
|
Insoluble
|
| Solubility in DMSO
|
5 mg/mL
|
| Hazards
|
| GHS labelling:[1]
|
|
|
|
|
|
Warning
|
|
|
H302, H312, H332
|
|
|
P280
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
NS-398 is a COX-2 inhibitor used in the study of the function of cyclooxygenases.[2]
See also
References
|
|---|
Receptor (ligands) | | DP (D2)Tooltip Prostaglandin D2 receptor | | DP1Tooltip Prostaglandin D2 receptor 1 | |
|---|
| DP2Tooltip Prostaglandin D2 receptor 2 | |
|---|
|
|---|
| EP (E2)Tooltip Prostaglandin E2 receptor | | EP1Tooltip Prostaglandin EP1 receptor |
- Antagonists: AH-6809
- ONO-8130
- SC-19220
- SC-51089
- SC-51322
|
|---|
| EP2Tooltip Prostaglandin EP2 receptor |
- Antagonists: AH-6809
- PF-04418948
- TG 4-155
|
|---|
| EP3Tooltip Prostaglandin EP3 receptor | |
|---|
| EP4Tooltip Prostaglandin EP4 receptor |
- Antagonists: Grapiprant
- GW-627368
- L-161982
- ONO-AE3-208
|
|---|
| Unsorted | |
|---|
|
|---|
| FP (F2α)Tooltip Prostaglandin F receptor | |
|---|
| IP (I2)Tooltip Prostacyclin receptor | |
|---|
| TP (TXA2)Tooltip Thromboxane receptor | |
|---|
| Unsorted |
- Arbaprostil
- Ataprost
- Ciprostene
- Clinprost
- Cobiprostone
- Delprostenate
- Deprostil
- Dimoxaprost
- Doxaprost
- Ecraprost
- Eganoprost
- Enisoprost
- Eptaloprost
- Esuberaprost
- Etiproston
- Fenprostalene
- Flunoprost
- Froxiprost
- Lanproston
- Limaprost
- Luprostiol
- Meteneprost
- Mexiprostil
- Naxaprostene
- Nileprost
- Nocloprost
- Ornoprostil
- Oxoprostol
- Penprostene
- Pimilprost
- Piriprost
- Posaraprost
- Prostalene
- Rioprostil
- Rivenprost
- Rosaprostol
- Spiriprostil
- Tiaprost
- Tilsuprost
- Tiprostanide
- Trimoprostil
- Viprostol
|
|---|
|
|---|
Enzyme (inhibitors) | COX (PTGS) | |
|---|
| PGD2STooltip Prostaglandin D synthase | |
|---|
| PGESTooltip Prostaglandin E synthase | HQL-79 |
|---|
| PGFSTooltip Prostaglandin F synthase | |
|---|
| PGI2STooltip Prostacyclin synthase | |
|---|
| TXASTooltip Thromboxane A synthase | |
|---|
|
|---|
| Others | |
|---|
- See also
- Receptor/signaling modulators
- Leukotriene signaling modulators
|