Niludipine
|
|
| Names
|
Preferred IUPAC name
Bis(2-propoxyethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
|
| Other names
2,6-Dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid bis(2-propoxyethyl) ester
|
| Identifiers
|
|
|
|
|
|
|
| ChemSpider
|
|
| ECHA InfoCard
|
100.041.003
|
| EC Number
|
|
| MeSH
|
C019497
|
|
|
|
| UNII
|
|
|
|
|
InChI=1S/C25H34N2O8/c1-5-10-32-12-14-34-24(28)21-17(3)26-18(4)22(25(29)35-15-13-33-11-6-2)23(21)19-8-7-9-20(16-19)27(30)31/h7-9,16,23,26H,5-6,10-15H2,1-4H3 Key: VZWXXKDFACOXNT-UHFFFAOYSA-N InChI=1/C25H34N2O8/c1-5-10-32-12-14-34-24(28)21-17(3)26-18(4)22(25(29)35-15-13-33-11-6-2)23(21)19-8-7-9-20(16-19)27(30)31/h7-9,16,23,26H,5-6,10-15H2,1-4H3 Key: VZWXXKDFACOXNT-UHFFFAOYAS
|
CCCOCCOC(=O)C1=C(NC(=C(C1C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OCCOCCC)C)C
|
| Properties
|
|
|
C25H34N2O8
|
| Molar mass
|
490.553 g·mol−1
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
Niludipine is a calcium channel blocker of the dihydropyridine class. It is a vasodilator that acts upon the coronary arteries of the heart-lung. It was found to produce a calcium antagonistic effect on the smooth muscle of hearts of canines and guinea pigs inhibiting myocardial oxidative metabolism.[1]
References
- ^ Hashimoto, K (1979). "Effects of niludipine on the Cardiovascular system with a note on its Calcium-Antagonistic effects". Arzneimittel-Forschung. 29 (9): 1368–73. PMID 583243.
|
|---|
| Calcium | | VDCCsTooltip Voltage-dependent calcium channels | |
|---|
|
|---|
| Potassium | | VGKCsTooltip Voltage-gated potassium channels | |
|---|
| IRKsTooltip Inwardly rectifying potassium channel | | Blockers | |
|---|
| Activators |
- GIRKTooltip G protein-coupled inwardly rectifying potassium channel-specific: ML-297 (VU0456810)
|
|---|
|
|---|
| KCaTooltip Calcium-activated potassium channel | |
|---|
| K2PsTooltip Tandem pore domain potassium channel | |
|---|
|
|---|
| Sodium | | VGSCsTooltip Voltage-gated sodium channels | |
|---|
| ENaCTooltip Epithelial sodium channel | |
|---|
| ASICsTooltip Acid-sensing ion channel | |
|---|
|
|---|
| Chloride | | CaCCsTooltip Calcium-activated chloride channel | |
|---|
| CFTRTooltip Cystic fibrosis transmembrane conductance regulator | |
|---|
| Unsorted | |
|---|
|
|---|
| Others | | TRPsTooltip Transient receptor potential channels | |
|---|
| LGICsTooltip Ligand gated ion channels | |
|---|
|
|---|
See also: Receptor/signaling modulators • Transient receptor potential channel modulators |