Tamarixetin
|
|
| Names
|
| IUPAC name
3,3′,5,7-Tetrahydroxy-4′-methoxyflavone
|
Systematic IUPAC name
3,5,7-Trihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one
|
| Other names
4'-Methylquercetin; 4'-O-Methylquercetin; Quercetin 4'-methyl ether
|
| Identifiers
|
|
|
|
|
|
|
| ChEBI
|
|
| ChemSpider
|
|
| ECHA InfoCard
|
100.009.137
|
|
|
|
| UNII
|
|
|
|
|
InChI=1S/C16H12O7/c1-22-11-3-2-7(4-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-6,17-19,21H,1H3 Key: FPLMIPQZHHQWHN-UHFFFAOYSA-N InChI=1/C16H12O7/c1-22-11-3-2-7(4-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-6,17-19,21H,1H3 Key: FPLMIPQZHHQWHN-UHFFFAOYAK
|
COC1=CC=C(C=C1O)C1=C(O)C(=O)C2=C(O1)C=C(O)C=C2O
|
| Properties
|
|
|
C16H12O7
|
| Molar mass
|
316.265 g·mol−1
|
| Melting point
|
307 °C (585 °F; 580 K)
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
Tamarixetin is an O-methylated flavonol, a naturally occurring flavonoid. It has been isolated from Tamarix ramosissima.[1]
See also
References
- ^ Sultanova, N.; Makhmoor, T.; Abilov, Z.A; Parween, Z.; Omurkamzinova, V.B; Ur-Rahman, Atta-; Choudhary, M.Iqbal (2001). "Antioxidant and antimicrobial activities of Tamarix ramosissima". Journal of Ethnopharmacology. 78 (2–3): 201–205. doi:10.1016/S0378-8741(01)00354-3. PMID 11694365.
Flavonols and their conjugates |
|---|
| Backbone | |
|---|
| Flavonols | | Aglycones | |
|---|
| Conjugates | | Glycosides of herbacetin | |
|---|
| Glycosides of kaempferol |
- Afzelin (Kaempferol 3-rhamnoside)
- Astragalin (kaempferol 3-O-glucoside)
- Kaempferitrin (kaempferol 3,7-dirhamnoside)
- Juglanin (Kaempferol 3-O-arabinoside)
- Kaempferol 3-alpha-L-arabinopyranoside
- Kaempferol 3-alpha-D-arabinopyranoside
- Kaempferol 7-alpha-L-arabinoside
- Kaempferol 7-O-glucoside
- Kaempferol 3-lathyroside
- Kaempferol 4'-rhamnoside
- Kaempferol 5-rhamnoside
- Kaempferol 7-rhamnoside
- Kaempferol 7-O-alpha-L-rhamnofuranoside
- Kaempferol 3-xyloside
- Kaempferol 7-xyloside
- Robinin (kaempferol-3-O-robinoside-7-O-rhamnoside)
- Kaempferol 3-O-rutinoside
- Sophoraflavonoloside (Kaempferol 3-O-sophoroside)
- Trifolin (Kaempferol 3-O-beta-D-galactoside)
|
|---|
| Glycosides of myricetin | |
|---|
| Conjugates of quercetin | |
|---|
|
|---|
|
|---|
| O-Methylated flavonols | | Aglycones | |
|---|
| Glycosides | | of isorhamnetin |
- Narcissin (Isorhamnetin 3-O-rutinoside)
- Isorhamnetin 3-O-glucoside
- Tamarixetin 7-rutinoside
|
|---|
| other |
- Azalein (Azaleatin 3-O-α-L-rhamnoside)
- Centaurein (Centaureidin 7-O-glucoside)
- Eupalin (Eupalitin 3-0-rhamnoside)
- Eupatolin (Eupatolitin 3-O-rhamnoside)
- Jacein (Jaceidin 7-O-glucoside)
- Patulitrin (Patuletin 7-O-glucoside
- Xanthorhamnin (Rhamnetin glycoside)
|
|---|
|
|---|
|
|---|
| Derivative flavonols | | Aglycones |
- Noricaritin
- Dihydronoricaritin
|
|---|
| Glycosides | |
|---|
|
|---|
| Pyranoflavonols | |
|---|
| Furanoflavonols | |
|---|
| Semisynthetic | |
|---|