Viniferal
|
|
| Names
|
Preferred IUPAC name
(2R,2′S,3R,3′S)-3′-(3,5-Dihydroxyphenyl)-6′-hydroxy-2,2′-bis(4-hydroxyphenyl)[3,4′-bi-1-benzofuran]-5-carbaldehyde
|
| Other names
(−)-Viniferal
|
| Identifiers
|
|
|
|
|
|
|
| ChEBI
|
|
| ChEMBL
|
|
| ChemSpider
|
|
|
|
|
|
|
|
InChI=1S/C35H26O8/c36-17-18-1-10-29-27(11-18)32(35(42-29)20-4-8-23(38)9-5-20)28-15-26(41)16-30-33(28)31(21-12-24(39)14-25(40)13-21)34(43-30)19-2-6-22(37)7-3-19/h1-17,31-32,34-35,37-41H/t31-,32-,34+,35-/m0/s1 Y Key: DHTHKPNODOWMKF-VPIGGYNKSA-N Y InChI=1/C35H26O8/c36-17-18-1-10-29-27(11-18)32(35(42-29)20-4-8-23(38)9-5-20)28-15-26(41)16-30-33(28)31(21-12-24(39)14-25(40)13-21)34(43-30)19-2-6-22(37)7-3-19/h1-17,31-32,34-35,37-41H/t31-,32-,34+,35-/m0/s1 Key: DHTHKPNODOWMKF-VPIGGYNKBX
|
O=CC1=CC=C(O[C@@H](C2=CC=C(O)C=C2)[C@@H]3C4=CC(O)=CC5=C4[C@H](C6=CC(O)=CC(O)=C6)[C@@H](C7=CC=C(O)C=C7)O5)C3=C1
|
| Properties
|
|
|
C35H26O8
|
| Molar mass
|
574.585 g·mol−1
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
Viniferal is a hydroxystilbenoid with an aldehyde group found in Vitis vinifera (grapevine).[1]
References
External links
|
|---|
- Diptoindonesin C
- Diptoindonesin F
- Gnetin H
- Hemsleyanol D
- Isohopeaphenol
- Laetevirenol A, B, C, D and E
- Suffruticosol A and B
- E-ω-viniferin
- Z-ω-viniferin
|
| Dimers |
- Diptoindonesin G
- Jezonodione
- B
- Scirpusin A
- Tibeticanol (piceatannol dimer)
|
|---|
| Trimers |
- Amurensin B
- Gnetin E
- Gneyulin A
- Johorenol A
- Ampelopsin E
- Vaticanol G
|
|---|
| Tetramers: |
- Dibalanocarpol
- Gnetin J (3"-hydroxygnetin E)
- Gnetin K (3"-methoxygnetin E)
- Gnetuhainin R (isorhapontigenin tetramer)
- Laetevirenol F and G
|
|---|
Higher polymers (five units or more) | |
|---|
Oligomeric forms of resveratrol | | Dimers | |
|---|
| Trimers | |
|---|
| Tetramers | |
|---|
| Pentamers | |
|---|
| Hexamers | |
|---|
| Higher polymers |
- γ-viniferin
- Valeriaphenol A
|
|---|
|
|---|
| Glycosides or conjugates |
- Diptoindonesin A (C-glucoside of ε-viniferin)
- Foeniculoside I (glucoside of miyabenol C), II, III and IV
- Laevifonol (an ε-viniferin-ascorbic acid hybrid compound)
- Laevifoside (O-glucoside of ampelopsin A)
|
|---|