Gallagic acid
|
|
| Names
|
Preferred IUPAC name
2,2′-(1,2,6,7-Tetrahydroxy-4,9-dioxo-4,9-dihydro-[1]benzopyrano[5,4,3-cde][1]benzopyran-3,8-diyl)bis(3,4,5-trihydroxybenzoic acid)
|
| Identifiers
|
|
|
|
|
|
|
| ChemSpider
|
|
|
|
|
| UNII
|
|
|
|
|
InChI=1S/C28H14O18/c29-5-1-3(25(39)40)7(17(33)15(5)31)9-13-11-12-14(28(44)46-23(11)21(37)19(9)35)10(20(36)22(38)24(12)45-27(13)43)8-4(26(41)42)2-6(30)16(32)18(8)34/h1-2,29-38H,(H,39,40)(H,41,42) Key: ZASJRRFAYSNSHU-UHFFFAOYSA-N
|
Oc4c6c1c(c5c(=O)o6)c(oc(=O)c1c(c4O)-c(c(O)c2O)c(C(O)=O)cc2O)c(O)c(O)c5-c3c(C(O)=O)cc(O)c(O)c3O
|
| Properties
|
|
|
C28H14O18
|
| Molar mass
|
638.39 g/mol
|
| Related compounds
|
Related compounds
|
Gallagic acid dilactone; gallagyldilactone; terminalin
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
Gallagic acid is a polyphenolic chemical compound that can be found in the ellagitannins, a type of tannin, found in Punica granatum (pomegranate).[1] It is a building block of the corresponding tannin punicalagin, punicalin, punicacortein C and 2-O-galloyl-punicalin.
References
- ^ Antioxidant, antimalarial and antimicrobial activities of tannin-rich fractions, ellagitannins and phenolic acids from Punica granatum L. Reddy Muntha K., Gupta Sashi K., Jacob Melissa R., Khan Shabana I. and Ferreira Daneel, Planta medica, 2007, vol. 73, no5, pp. 461-467, INIST 18773247
|
|---|
| Moieties | |
|---|
| Lactones | |
|---|
| Monomers |
- Acetonyl geraniin
- Alnusiin
- Bicornin
- Carlesiin
- Casuarictin
- Emblicanin A and B
- Euscaphinin
- Galloyl pedunculagin
- Grandinin
- Helioscopinin B
- Jolkinin
- Lagerstannin A, B and C
- Macranganin
- Myrobalanitannin
- Nupharin A, B, C, D, E and F
- Pedunculagin
- Punicalagin
- Punigluconin
- Phyllanemblinin A, B, C, D, E and F
- Punicalin
- Roburin E
- Rugosin E
- Sanguiin H-5
- Stenophyllanin A, B and C
- Strictinin
- Tellimagrandin I and II
- Teracatain
- Terchebulin
- Terflavin A and B
- Tergallic acid
- Tergallic acid dilactone
| C-glycosidic ellagitannins | |
|---|
Dehydroellagitannins (molecules with dehydrohexahydroxydiphenic acid (DHHDP) | |
|---|
| Transformed ellagitannins | | molecules with chebulic acid | |
|---|
| molecules with Elaeocarpusinic acid |
- Elaeocarpusin
- Helioscopin B
- Mallojaponin (1-O-Galloyl-2,4-elaeocarpusinoyl-3,6-(R)-valoneayl-beta-D-glucose)
|
|---|
|
|---|
|
|---|
| Oligomers | |
|---|
| Other | |
|---|