Mallotusinic acid
|
|
| Names
|
| Other names
|
| Identifiers
|
|
|
|
|
|
|
| KEGG
|
|
|
|
|
|
|
|
InChI=1S/C48H32O32/c49-15-1-9(2-16(50)27(15)55)41(65)79-46-39-38-36(76-45(69)13-7-22(54)48(72)47(70,71)26(13)25-11(43(67)78-39)4-19(53)30(58)37(25)80-48)21(75-46)8-73-42(66)10-3-17(51)28(56)32(60)23(10)24-12(44(68)77-38)6-20(31(59)33(24)61)74-35-14(40(63)64)5-18(52)29(57)34(35)62/h1-7,21,26,36,38-39,46,49-53,55-62,70-72H,8H2,(H,63,64) Key: MWPRJJBXNINUTQ-UHFFFAOYSA-N
|
Oc2c(O)cc(cc2O)C(=O)OC5OC6COC(=O)c(cc(O)c(O)c4O)c4-c(c(O)c(O)c7Oc8c(C(O)=O)cc(O)c(O)c8O)cc7C(=O)OC(C5OC(=O)c3cc(O)c1O)C6OC(=O)C%10=CC(=O)C9(O)Oc1c3C%10C9(O)O
|
| Properties
|
|
|
C48H32O32
|
| Molar mass
|
1120.74 g/mol
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
Mallotusinic acid is a hydrolysable tannin found in the bark of Mallotus japonicus.[2] It is more generally present in Geraniales.[3]
References
- ^ Tabata, Hiromasa; Katsube, Takuya; Moriya, Koko; Utsumi, Toshihiko; Yamasaki, Yukikazu (2010). "Protective activity of components of an edible plant, Mallotus japonicus, against oxidative modification of proteins and lipids". Food Chemistry. 118 (3): 548. doi:10.1016/j.foodchem.2009.05.033.
- ^ Saijo, R; Nonaka, G; Nishioka, I (1989). "Tannins and related compounds. LXXXIV. Isolation and characterization of five new hydrolyzable tannins from the bark of Mallotus japonicus". Chemical & Pharmaceutical Bulletin. 37 (8): 2063–70. doi:10.1248/cpb.37.2063. PMID 2598308.
- ^ Okuda, Takuo; Mori, Kazuko; Hatano, Tsutomu (1980). "The distribution of geraniin and mallotusinic acid in the order geraniales". Phytochemistry. 19 (4): 547–551. Bibcode:1980PChem..19..547O. doi:10.1016/0031-9422(80)87012-9.
|
|---|
| Moieties | |
|---|
| Lactones | |
|---|
| Monomers |
- Acetonyl geraniin
- Alnusiin
- Bicornin
- Carlesiin
- Casuarictin
- Emblicanin A and B
- Euscaphinin
- Galloyl pedunculagin
- Grandinin
- Helioscopinin B
- Jolkinin
- Lagerstannin A, B and C
- Macranganin
- Myrobalanitannin
- Nupharin A, B, C, D, E and F
- Pedunculagin
- Punicalagin
- Punigluconin
- Phyllanemblinin A, B, C, D, E and F
- Punicalin
- Roburin E
- Rugosin E
- Sanguiin H-5
- Stenophyllanin A, B and C
- Strictinin
- Tellimagrandin I and II
- Teracatain
- Terchebulin
- Terflavin A and B
- Tergallic acid
- Tergallic acid dilactone
| C-glycosidic ellagitannins | |
|---|
Dehydroellagitannins (molecules with dehydrohexahydroxydiphenic acid (DHHDP) |
- Alnicortin
- Euphorbin A
- Euphorscopin
- Excoecarianin
- Geraniin
- Granatin A and B
- Helioscopinin A
- Supinanin
- Terchebin
|
|---|
| Transformed ellagitannins | | molecules with chebulic acid | |
|---|
| molecules with Elaeocarpusinic acid |
- Elaeocarpusin
- Helioscopin B
- Mallojaponin (1-O-Galloyl-2,4-elaeocarpusinoyl-3,6-(R)-valoneayl-beta-D-glucose)
|
|---|
|
|---|
|
|---|
| Oligomers | |
|---|
| Other | |
|---|